(4-Oxo-4H-quinazolin-3-yl)-acetic acid 127093B racemate but is significantly less effective

but is significantly less effective at suppressing LPS endotoxin stimulation of HEK:TLR4 cells or R848 stimulation of HEK:TLR7 cells

and cholesterol levels in ZDF rats

CAS Number: 1597403-47-8

and IC50 is approximately 155 μM

(4-Oxo-4H-quinazolin-3-yl)-acetic acid 127093B racemate but is significantly less effective(4 Oxo 4H quinazolin 3 yl) acetic acid is an alkyl chain based PROTAC linker that can be used in the synthesis of PROTACs. Product information CAS Number: 14663 53 7 Molecular Weight: 204. 18 Formula: C10H8N2O3 Chemical Name: 2 (4 oxo 3,4 dihydroquinazolin 3 yl)acetic acid Smiles: OC(=O)CN1C=NC2=CC=CC=C2C1=O InChiKey: BBBICQPTZBHLBM UHFFFAOYSA N InChi: InChI=1S C10H8N2O3 c13 9(14)5 12 6 11 8 4 2 1 3 7(8)10(12)15 h1 4,6H,5H2,(H,13,14) Technical Data